C18H24N4O8 — CID 130433337
(2S)-2-[[(1S)-1-carboxy-5-(pyridine-2-carbonylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 130433337) has the molecular formula C18H24N4O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-(pyridine-2-carbonylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-(pyridine-2-carbonylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130433337 |
| Molecular Formula | C18H24N4O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-(pyridine-2-carbonylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)c1ccccn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H24N4O8/c23-14(24)8-7-13(17(28)29)22-18(30)21-12(16(26)27)6-2-4-10-20-15(25)11-5-1-3-9-19-11/h1,3,5,9,12-13H,2,4,6-8,10H2,(H,20,25)(H,23,24)(H,26,27)(H,28,29)(H2,21,22,30)/t12-,13-/m0/s1 |
| InChIKey | YAEDXTXSNKVCIW-STQMWFEESA-N |
| XLogP | 0.05 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|