C20H18FN7O2 — CID 130433448
(9S)-5-(2-fluoro-4-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 130433448) has the molecular formula C20H18FN7O2 and a molecular weight of 407.41 g/mol. Its IUPAC name is (9S)-5-(2-fluoro-4-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(2-fluoro-4-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 130433448 |
| Molecular Formula | C20H18FN7O2 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (9S)-5-(2-fluoro-4-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4ccnc(F)c4)ccc3N3CC[C@H]2C3)ncn1 |
| InChI | InChI=1S/C20H18FN7O2/c1-30-18-9-17(23-11-24-18)26-20(29)28-13-5-7-27(10-13)15-3-2-14(25-19(15)28)12-4-6-22-16(21)8-12/h2-4,6,8-9,11,13H,5,7,10H2,1H3,(H,23,24,26,29)/t13-/m0/s1 |
| InChIKey | XPBNXMJTZDKXQB-ZDUSSCGKSA-N |
| XLogP | 2.71 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|