About 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine
4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine (PubChem CID 13043387) has the molecular formula C19H20ClN5OS
and a molecular weight of 401.92 g/mol. Its IUPAC name is 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine |
| PubChem CID | 13043387 |
| Molecular Formula | C19H20ClN5OS |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2nc(Cl)nc3c(SCc4ccccc4)ncnc23)CC(C)O1 |
| InChI | InChI=1S/C19H20ClN5OS/c1-12-8-25(9-13(2)26-12)17-15-16(23-19(20)24-17)18(22-11-21-15)27-10-14-6-4-3-5-7-14/h3-7,11-13H,8-10H2,1-2H3 |
| InChIKey | DUZXVHMKOCVNKZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine (CID 13043387) is 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine is CC1CN(c2nc(Cl)nc3c(SCc4ccccc4)ncnc23)CC(C)O1.
What is the InChIKey of 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine?
The InChIKey is DUZXVHMKOCVNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN5OS/c1-12-8-25(9-13(2)26-12)17-15-16(23-19(20)24-17)18(22-11-21-15)27-10-14-6-4-3-5-7-14/h3-7,11-13H,8-10H2,1-2H3.
What are the key properties of 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine?
4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine has a molecular weight of 401.92 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-benzylsulfanyl-2-chloropyrimido[5,4-d]pyrimidin-4-yl)-2,6-dimethylmorpholine is sourced from PubChem (CID 13043387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).