C19H20ClN5O2S — CID 13043412
4-[2-chloro-8-(3-phenylpropoxy)pyrimido[5,4-d]pyrimidin-4-yl]-1,4-thiazinane 1-oxide (PubChem CID 13043412) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-[2-chloro-8-(3-phenylpropoxy)pyrimido[5,4-d]pyrimidin-4-yl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[2-chloro-8-(3-phenylpropoxy)pyrimido[5,4-d]pyrimidin-4-yl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 13043412 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-[2-chloro-8-(3-phenylpropoxy)pyrimido[5,4-d]pyrimidin-4-yl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(c2nc(Cl)nc3c(OCCCc4ccccc4)ncnc23)CC1 |
| InChI | InChI=1S/C19H20ClN5O2S/c20-19-23-16-15(17(24-19)25-8-11-28(26)12-9-25)21-13-22-18(16)27-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,13H,4,7-12H2 |
| InChIKey | HCOJNPNSUPSKRG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|