C10H13N3O2S — CID 130434500
6-sulfanylidene-12-oxa-1,5,7-triazatricyclo[8.4.0.03,8]tetradec-3(8)-en-4-one (PubChem CID 130434500) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 6-sulfanylidene-12-oxa-1,5,7-triazatricyclo[8.4.0.03,8]tetradec-3(8)-en-4-one.
| Compound Name | 6-sulfanylidene-12-oxa-1,5,7-triazatricyclo[8.4.0.03,8]tetradec-3(8)-en-4-one |
|---|---|
| PubChem CID | 130434500 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 6-sulfanylidene-12-oxa-1,5,7-triazatricyclo[8.4.0.03,8]tetradec-3(8)-en-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN1CCOCC1C2 |
| InChI | InChI=1S/C10H13N3O2S/c14-9-7-4-13-1-2-15-5-6(13)3-8(7)11-10(16)12-9/h6H,1-5H2,(H2,11,12,14,16) |
| InChIKey | FXXBIJYROPJYMC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|