C25H22F2N6OS — CID 130434939
(4S,6R)-2-amino-4-[5-[[3-[(2S)-but-3-yn-2-yl]oxy-1,7-naphthyridin-8-yl]amino]-2,3-difluorophenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carbonitrile (PubChem CID 130434939) has the molecular formula C25H22F2N6OS and a molecular weight of 492.56 g/mol. Its IUPAC name is (4S,6R)-2-amino-4-[5-[[3-[(2S)-but-3-yn-2-yl]oxy-1,7-naphthyridin-8-yl]amino]-2,3-difluorophenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carbonitrile.
| Compound Name | (4S,6R)-2-amino-4-[5-[[3-[(2S)-but-3-yn-2-yl]oxy-1,7-naphthyridin-8-yl]amino]-2,3-difluorophenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carbonitrile |
|---|---|
| PubChem CID | 130434939 |
| Molecular Formula | C25H22F2N6OS |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (4S,6R)-2-amino-4-[5-[[3-[(2S)-but-3-yn-2-yl]oxy-1,7-naphthyridin-8-yl]amino]-2,3-difluorophenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carbonitrile |
| SMILES | C#C[C@H](C)Oc1cnc2c(Nc3cc(F)c(F)c([C@]4(C)C[C@](C)(C#N)SC(N)=N4)c3)nccc2c1 |
| InChI | InChI=1S/C25H22F2N6OS/c1-5-14(2)34-17-8-15-6-7-30-22(21(15)31-11-17)32-16-9-18(20(27)19(26)10-16)25(4)12-24(3,13-28)35-23(29)33-25/h1,6-11,14H,12H2,2-4H3,(H2,29,33)(H,30,32)/t14-,24+,25-/m0/s1 |
| InChIKey | QWOMMNUTTRKAAO-CJKSILLISA-N |
| XLogP | 5.00 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|