C24H24F2N6O3S2 — CID 130435304
(4S,5S,6R)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine (PubChem CID 130435304) has the molecular formula C24H24F2N6O3S2 and a molecular weight of 546.63 g/mol. Its IUPAC name is (4S,5S,6R)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,5S,6R)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 130435304 |
| Molecular Formula | C24H24F2N6O3S2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | (4S,5S,6R)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine |
| SMILES | C#CCOc1cnc2c(Nc3cc(F)c(F)c([C@@]4(C)N=C(N)S[C@](C)(S(C)(=O)=O)[C@H]4C)c3)nccc2n1 |
| InChI | InChI=1S/C24H24F2N6O3S2/c1-6-9-35-18-12-29-20-17(31-18)7-8-28-21(20)30-14-10-15(19(26)16(25)11-14)23(3)13(2)24(4,37(5,33)34)36-22(27)32-23/h1,7-8,10-13H,9H2,2-5H3,(H2,27,32)(H,28,30)/t13-,23-,24+/m0/s1 |
| InChIKey | BLCUALHLKSVPLR-XKWDIYCSSA-N |
| XLogP | 3.73 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|