C17H33NS — CID 130435642
(3E,5Z)-4-tert-butyl-1-(2,2-dimethylpropylsulfanyl)octa-3,5-dien-3-amine (PubChem CID 130435642) has the molecular formula C17H33NS and a molecular weight of 283.53 g/mol. Its IUPAC name is (3E,5Z)-4-tert-butyl-1-(2,2-dimethylpropylsulfanyl)octa-3,5-dien-3-amine.
| Compound Name | (3E,5Z)-4-tert-butyl-1-(2,2-dimethylpropylsulfanyl)octa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 130435642 |
| Molecular Formula | C17H33NS |
| Molecular Weight | 283.53 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (3E,5Z)-4-tert-butyl-1-(2,2-dimethylpropylsulfanyl)octa-3,5-dien-3-amine |
| SMILES | CC/C=C\C(=C(/N)CCSCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H33NS/c1-8-9-10-14(17(5,6)7)15(18)11-12-19-13-16(2,3)4/h9-10H,8,11-13,18H2,1-7H3/b10-9-,15-14+ |
| InChIKey | XOFYJPXPKGLLCM-PJYIHAPCSA-N |
| XLogP | 5.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|