C12H16F2O — CID 130435926
6-[(1Z,3Z)-1,2-difluoro-3-methylpenta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyran (PubChem CID 130435926) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 6-[(1Z,3Z)-1,2-difluoro-3-methylpenta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyran.
| Compound Name | 6-[(1Z,3Z)-1,2-difluoro-3-methylpenta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 130435926 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-[(1Z,3Z)-1,2-difluoro-3-methylpenta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyran |
| SMILES | C/C=C(C)\C(F)=C(\F)C1=CCCC(C)O1 |
| InChI | InChI=1S/C12H16F2O/c1-4-8(2)11(13)12(14)10-7-5-6-9(3)15-10/h4,7,9H,5-6H2,1-3H3/b8-4-,12-11- |
| InChIKey | WKJRKZHTIPUUDW-JYYRYHNYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|