About 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one
1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one (PubChem CID 130436568) has the molecular formula C18H33F2NO
and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one.
Molecular Properties
| Compound Name | 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one |
| PubChem CID | 130436568 |
| Molecular Formula | C18H33F2NO |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one |
| SMILES | CCCCCCCC(CCCCC)C(=O)[C@@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C18H33F2NO/c1-3-5-7-8-10-12-15(11-9-6-4-2)17(22)16-13-18(19,20)14-21-16/h15-16,21H,3-14H2,1-2H3/t15?,16-/m0/s1 |
| InChIKey | FMRNRKVQPSUNAP-LYKKTTPLSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one?
The IUPAC name of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one (CID 130436568) is 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one.
What is the SMILES notation for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one?
The canonical SMILES for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one is CCCCCCCC(CCCCC)C(=O)[C@@H]1CC(F)(F)CN1.
What is the InChIKey of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one?
The InChIKey is FMRNRKVQPSUNAP-LYKKTTPLSA-N. The full InChI is InChI=1S/C18H33F2NO/c1-3-5-7-8-10-12-15(11-9-6-4-2)17(22)16-13-18(19,20)14-21-16/h15-16,21H,3-14H2,1-2H3/t15?,16-/m0/s1.
What are the key properties of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one?
1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one has a molecular weight of 317.46 g/mol, XLogP of 5.11, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-pentylnonan-1-one is sourced from PubChem (CID 130436568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).