C8H11N3 — CID 130436682
4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole (PubChem CID 130436682) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 130436682 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole |
| SMILES | C/C=C\C(=C/C)n1cnnc1 |
| InChI | InChI=1S/C8H11N3/c1-3-5-8(4-2)11-6-9-10-7-11/h3-7H,1-2H3/b5-3-,8-4+ |
| InChIKey | ODMTWZCKOKHVCU-VOGDQUTBSA-N |
| XLogP | 1.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|