C16H15IN4O2S — CID 130436777
2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-propylimidazo[4,5-c]pyridin-4-amine (PubChem CID 130436777) has the molecular formula C16H15IN4O2S and a molecular weight of 454.29 g/mol. Its IUPAC name is 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-propylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-propylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 130436777 |
| Molecular Formula | C16H15IN4O2S |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-propylimidazo[4,5-c]pyridin-4-amine |
| SMILES | CCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)nccc21 |
| InChI | InChI=1S/C16H15IN4O2S/c1-2-5-21-10-3-4-19-15(18)14(10)20-16(21)24-13-7-12-11(6-9(13)17)22-8-23-12/h3-4,6-7H,2,5,8H2,1H3,(H2,18,19) |
| InChIKey | ROXDIFNVUGEUHV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|