C12H23N3 — CID 130436838
(1Z)-N,N-dimethyl-3-(4-methyl-1,4-diazepan-1-yl)buta-1,3-dien-1-amine (PubChem CID 130436838) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (1Z)-N,N-dimethyl-3-(4-methyl-1,4-diazepan-1-yl)buta-1,3-dien-1-amine.
| Compound Name | (1Z)-N,N-dimethyl-3-(4-methyl-1,4-diazepan-1-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 130436838 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (1Z)-N,N-dimethyl-3-(4-methyl-1,4-diazepan-1-yl)buta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\N(C)C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C12H23N3/c1-12(6-9-13(2)3)15-8-5-7-14(4)10-11-15/h6,9H,1,5,7-8,10-11H2,2-4H3/b9-6- |
| InChIKey | ZTQWYOOAKDIWMV-TWGQIWQCSA-N |
| XLogP | 1.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|