C28H26F3N5OS — CID 130437291
(4R)-1,4-dimethyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 130437291) has the molecular formula C28H26F3N5OS and a molecular weight of 537.61 g/mol. Its IUPAC name is (4R)-1,4-dimethyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (4R)-1,4-dimethyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 130437291 |
| Molecular Formula | C28H26F3N5OS |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | (4R)-1,4-dimethyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N(C)CC[C@H]3C)c2)cs1 |
| InChI | InChI=1S/C28H26F3N5OS/c1-17-12-13-35(3)25-11-10-23(19-6-4-8-21(14-19)28(29,30)31)34-26(25)36(17)27(37)33-22-9-5-7-20(15-22)24-16-38-18(2)32-24/h4-11,14-17H,12-13H2,1-3H3,(H,33,37)/t17-/m1/s1 |
| InChIKey | QYBYLLGIBQLTBW-QGZVFWFLSA-N |
| XLogP | 7.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |