C19H18N6O2 — CID 130437418
(5S)-9-(3,5-dimethyl-1,2-oxazol-4-yl)-N-pyridin-2-yl-2,6,8-triazatricyclo[5.4.0.02,5]undeca-1(7),8,10-triene-6-carboxamide (PubChem CID 130437418) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is (5S)-9-(3,5-dimethyl-1,2-oxazol-4-yl)-N-pyridin-2-yl-2,6,8-triazatricyclo[5.4.0.02,5]undeca-1(7),8,10-triene-6-carboxamide.
| Compound Name | (5S)-9-(3,5-dimethyl-1,2-oxazol-4-yl)-N-pyridin-2-yl-2,6,8-triazatricyclo[5.4.0.02,5]undeca-1(7),8,10-triene-6-carboxamide |
|---|---|
| PubChem CID | 130437418 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (5S)-9-(3,5-dimethyl-1,2-oxazol-4-yl)-N-pyridin-2-yl-2,6,8-triazatricyclo[5.4.0.02,5]undeca-1(7),8,10-triene-6-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN21 |
| InChI | InChI=1S/C19H18N6O2/c1-11-17(12(2)27-23-11)13-6-7-14-18(21-13)25(16-8-10-24(14)16)19(26)22-15-5-3-4-9-20-15/h3-7,9,16H,8,10H2,1-2H3,(H,20,22,26)/t16-/m0/s1 |
| InChIKey | KKOJOGOXAGUHFW-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |