About methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate
methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate (PubChem CID 130437443) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate |
| PubChem CID | 130437443 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate |
| SMILES | COC(=O)CC1C=C(OC)C(OC)=CC1 |
| InChI | InChI=1S/C11H16O4/c1-13-9-5-4-8(6-10(9)14-2)7-11(12)15-3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | QBAARLUIADGUNF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate?
The IUPAC name of methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate (CID 130437443) is methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate.
What is the SMILES notation for methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate?
The canonical SMILES for methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate is COC(=O)CC1C=C(OC)C(OC)=CC1.
What is the InChIKey of methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate?
The InChIKey is QBAARLUIADGUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-13-9-5-4-8(6-10(9)14-2)7-11(12)15-3/h5-6,8H,4,7H2,1-3H3.
What are the key properties of methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate?
methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate has a molecular weight of 212.24 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dimethoxycyclohexa-2,4-dien-1-yl)acetate is sourced from PubChem (CID 130437443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).