About 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine
1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine (PubChem CID 130437836) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine |
| PubChem CID | 130437836 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine |
| SMILES | CC/C=C\C=C/CCC(C)N(C)N |
| InChI | InChI=1S/C11H22N2/c1-4-5-6-7-8-9-10-11(2)13(3)12/h5-8,11H,4,9-10,12H2,1-3H3/b6-5-,8-7- |
| InChIKey | PWMJZWWHZKIEFB-ISTTXYCBSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine?
The IUPAC name of 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine (CID 130437836) is 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine.
What is the SMILES notation for 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine?
The canonical SMILES for 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine is CC/C=C\C=C/CCC(C)N(C)N.
What is the InChIKey of 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine?
The InChIKey is PWMJZWWHZKIEFB-ISTTXYCBSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-5-6-7-8-9-10-11(2)13(3)12/h5-8,11H,4,9-10,12H2,1-3H3/b6-5-,8-7-.
What are the key properties of 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine?
1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine has a molecular weight of 182.31 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z,7Z)-deca-5,7-dien-2-yl]-1-methylhydrazine is sourced from PubChem (CID 130437836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).