C20H32O2 — CID 130437927
2,6-dimethyloct-7-en-2-yl (4S)-3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 130437927) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2,6-dimethyloct-7-en-2-yl (4S)-3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,6-dimethyloct-7-en-2-yl (4S)-3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 130437927 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2,6-dimethyloct-7-en-2-yl (4S)-3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=CC(C)CCCC(C)(C)OC(=O)C1C2C=C[C@H](C2)C1(C)C |
| InChI | InChI=1S/C20H32O2/c1-7-14(2)9-8-12-19(3,4)22-18(21)17-15-10-11-16(13-15)20(17,5)6/h7,10-11,14-17H,1,8-9,12-13H2,2-6H3/t14?,15?,16-,17?/m1/s1 |
| InChIKey | FTTXOXZWFYCUBX-ONNPGMOUSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|