C26H29FN6O2 — CID 130438191
[6-[[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-3-yl]amino]-2-fluoro-3-pyridinyl]-[4-(1-hydroxybutan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone (PubChem CID 130438191) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is [6-[[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-3-yl]amino]-2-fluoro-3-pyridinyl]-[4-(1-hydroxybutan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone.
| Compound Name | [6-[[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-3-yl]amino]-2-fluoro-3-pyridinyl]-[4-(1-hydroxybutan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 130438191 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [6-[[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-3-yl]amino]-2-fluoro-3-pyridinyl]-[4-(1-hydroxybutan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
| SMILES | C=C(/C=C\C(=C/C)Nc1ccc(C(=O)c2c[nH]c3ncnc(NC(CC)CO)c23)c(F)n1)C1CC1 |
| InChI | InChI=1S/C26H29FN6O2/c1-4-17(9-6-15(3)16-7-8-16)31-21-11-10-19(24(27)33-21)23(35)20-12-28-25-22(20)26(30-14-29-25)32-18(5-2)13-34/h4,6,9-12,14,16,18,34H,3,5,7-8,13H2,1-2H3,(H,31,33)(H2,28,29,30,32)/b9-6-,17-4+ |
| InChIKey | HODLZMDQCGWJTH-ACXTUTEOSA-N |
| XLogP | 4.74 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|