C20H27N5O9P2 — CID 130438273
[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-ethylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130438273) has the molecular formula C20H27N5O9P2 and a molecular weight of 543.41 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-ethylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-ethylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130438273 |
| Molecular Formula | C20H27N5O9P2 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-ethylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CCc1nc(NCc2ccccc2)c2ncn([C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H27N5O9P2/c1-2-14-23-18(21-8-12-6-4-3-5-7-12)15-19(24-14)25(10-22-15)20-17(27)16(26)13(34-20)9-33-36(31,32)11-35(28,29)30/h3-7,10,13,16-17,20,26-27H,2,8-9,11H2,1H3,(H,31,32)(H,21,23,24)(H2,28,29,30)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | OEQQDLAMOXOEFI-AEVYOOLXSA-N |
| XLogP | 0.96 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|