C21H33N3O8S — CID 130438405
[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 130438405) has the molecular formula C21H33N3O8S and a molecular weight of 487.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 130438405 |
| Molecular Formula | C21H33N3O8S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC[C@H]1O[C@@H](N2C=CCC(C(N)=O)=C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H33N3O8S/c1-21(2,3)32-20(29)23-13(7-9-33-4)19(28)30-11-14-15(25)16(26)18(31-14)24-8-5-6-12(10-24)17(22)27/h5,8,10,13-16,18,25-26H,6-7,9,11H2,1-4H3,(H2,22,27)(H,23,29)/t13-,14+,15+,16+,18+/m0/s1 |
| InChIKey | MZKHGJYWPNRIAV-CWIFOLKKSA-N |
| XLogP | 0.21 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |