C22H35N3O8 — CID 130438406
[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 130438406) has the molecular formula C22H35N3O8 and a molecular weight of 469.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 130438406 |
| Molecular Formula | C22H35N3O8 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC[C@H]1O[C@@H](N2C=CCC(C(N)=O)=C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H35N3O8/c1-12(2)9-14(24-21(30)33-22(3,4)5)20(29)31-11-15-16(26)17(27)19(32-15)25-8-6-7-13(10-25)18(23)28/h6,8,10,12,14-17,19,26-27H,7,9,11H2,1-5H3,(H2,23,28)(H,24,30)/t14-,15+,16+,17+,19+/m0/s1 |
| InChIKey | LNICJGJRSVLNHC-SEFVSHJNSA-N |
| XLogP | 0.50 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |