C27H31NO4 — CID 130438437
[(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-tert-butylbenzoate (PubChem CID 130438437) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-tert-butylbenzoate.
| Compound Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 130438437 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 4-tert-butylbenzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4ccc(C(C)(C)C)cc4)C=C[C@@]31CCN2C |
| InChI | InChI=1S/C27H31NO4/c1-26(2,3)18-8-6-17(7-9-18)25(29)31-19-12-13-27-14-15-28(4)20-10-11-21(30-5)24(23(20)27)32-22(27)16-19/h6-13,19,22H,14-16H2,1-5H3/t19-,22?,27-/m0/s1 |
| InChIKey | DTGPKZYKSRKNID-BBFIGBGXSA-N |
| XLogP | 5.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|