C64H69BrO5 — CID 130438601
[2-(hydroxymethyl)-3-methoxy-2-methyl-3-oxopropyl] 16-bromo-4,6,8,10,12,14,16-heptakis-phenylhexadecanoate (PubChem CID 130438601) has the molecular formula C64H69BrO5 and a molecular weight of 998.16 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-methoxy-2-methyl-3-oxopropyl] 16-bromo-4,6,8,10,12,14,16-heptakis-phenylhexadecanoate.
| Compound Name | [2-(hydroxymethyl)-3-methoxy-2-methyl-3-oxopropyl] 16-bromo-4,6,8,10,12,14,16-heptakis-phenylhexadecanoate |
|---|---|
| PubChem CID | 130438601 |
| Molecular Formula | C64H69BrO5 |
| Molecular Weight | 998.16 g/mol |
| Exact Mass | 996.43 |
| IUPAC Name | [2-(hydroxymethyl)-3-methoxy-2-methyl-3-oxopropyl] 16-bromo-4,6,8,10,12,14,16-heptakis-phenylhexadecanoate |
| SMILES | COC(=O)C(C)(CO)COC(=O)CCC(CC(CC(CC(CC(CC(CC(Br)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C64H69BrO5/c1-64(46-66,63(68)69-2)47-70-62(67)39-38-55(48-24-10-3-11-25-48)40-56(49-26-12-4-13-27-49)41-57(50-28-14-5-15-29-50)42-58(51-30-16-6-17-31-51)43-59(52-32-18-7-19-33-52)44-60(53-34-20-8-21-35-53)45-61(65)54-36-22-9-23-37-54/h3-37,55-61,66H,38-47H2,1-2H3 |
| InChIKey | MEKCZVRBQRGCGJ-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.16 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|