About 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine
5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine (PubChem CID 130438746) has the molecular formula C16H12BrClFN3S2
and a molecular weight of 444.78 g/mol. Its IUPAC name is 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine.
Molecular Properties
| Compound Name | 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine |
| PubChem CID | 130438746 |
| Molecular Formula | C16H12BrClFN3S2 |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine |
| SMILES | Fc1c(Nc2ccc(Br)cc2Cl)c(NSC2CC2)cc2scnc12 |
| InChI | InChI=1S/C16H12BrClFN3S2/c17-8-1-4-11(10(18)5-8)21-15-12(22-24-9-2-3-9)6-13-16(14(15)19)20-7-23-13/h1,4-7,9,21-22H,2-3H2 |
| InChIKey | QLSINAXUPNSXCR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine?
The IUPAC name of 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine (CID 130438746) is 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine.
What is the SMILES notation for 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine?
The canonical SMILES for 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine is Fc1c(Nc2ccc(Br)cc2Cl)c(NSC2CC2)cc2scnc12.
What is the InChIKey of 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine?
The InChIKey is QLSINAXUPNSXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClFN3S2/c17-8-1-4-11(10(18)5-8)21-15-12(22-24-9-2-3-9)6-13-16(14(15)19)20-7-23-13/h1,4-7,9,21-22H,2-3H2.
What are the key properties of 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine?
5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine has a molecular weight of 444.78 g/mol, XLogP of 6.82, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(4-bromo-2-chlorophenyl)-6-N-cyclopropylsulfanyl-4-fluoro-1,3-benzothiazole-5,6-diamine is sourced from PubChem (CID 130438746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).