C23H31FO4S — CID 130438953
ditert-butyl (1S,2S,3R,5R,6S)-3-[(4-fluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 130438953) has the molecular formula C23H31FO4S and a molecular weight of 422.56 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3R,5R,6S)-3-[(4-fluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3R,5R,6S)-3-[(4-fluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 130438953 |
| Molecular Formula | C23H31FO4S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | ditert-butyl (1S,2S,3R,5R,6S)-3-[(4-fluorophenyl)sulfanylmethyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](CSc2ccc(F)cc2)C[C@H]2[C@H](C(=O)OC(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C23H31FO4S/c1-22(2,3)27-20(25)17-13(12-29-15-9-7-14(24)8-10-15)11-16-18(17)19(16)21(26)28-23(4,5)6/h7-10,13,16-19H,11-12H2,1-6H3/t13-,16+,17+,18+,19-/m0/s1 |
| InChIKey | JLVRTOAXWUKHAW-LDFOPSEGSA-N |
| XLogP | 5.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |