About 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile
3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile (PubChem CID 130438969) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile |
| PubChem CID | 130438969 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile |
| SMILES | Cc1cc(C(=O)CC#N)cnc1C |
| InChI | InChI=1S/C10H10N2O/c1-7-5-9(6-12-8(7)2)10(13)3-4-11/h5-6H,3H2,1-2H3 |
| InChIKey | VHGDVCRBNKHFMK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile?
The IUPAC name of 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile (CID 130438969) is 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile.
What is the SMILES notation for 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile?
The canonical SMILES for 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile is Cc1cc(C(=O)CC#N)cnc1C.
What is the InChIKey of 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile?
The InChIKey is VHGDVCRBNKHFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-7-5-9(6-12-8(7)2)10(13)3-4-11/h5-6H,3H2,1-2H3.
What are the key properties of 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile?
3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile has a molecular weight of 174.20 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethyl-3-pyridinyl)-3-oxopropanenitrile is sourced from PubChem (CID 130438969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).