C23H21Cl2NO4 — CID 130439003
[(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 2,4-dichlorobenzoate (PubChem CID 130439003) has the molecular formula C23H21Cl2NO4 and a molecular weight of 446.33 g/mol. Its IUPAC name is [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 2,4-dichlorobenzoate.
| Compound Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 130439003 |
| Molecular Formula | C23H21Cl2NO4 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 2,4-dichlorobenzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4ccc(Cl)cc4Cl)C=C[C@@]31CCN2C |
| InChI | InChI=1S/C23H21Cl2NO4/c1-26-10-9-23-8-7-14(29-22(27)15-4-3-13(24)11-16(15)25)12-19(23)30-21-18(28-2)6-5-17(26)20(21)23/h3-8,11,14,19H,9-10,12H2,1-2H3/t14-,19?,23-/m0/s1 |
| InChIKey | UNZCGBREJUIUCS-BIZKTGEDSA-N |
| XLogP | 5.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|