C28H29N4OP — CID 130439053
4-[(4-methylidenepiperidin-1-yl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]benzonitrile (PubChem CID 130439053) has the molecular formula C28H29N4OP and a molecular weight of 468.54 g/mol. Its IUPAC name is 4-[(4-methylidenepiperidin-1-yl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]benzonitrile.
| Compound Name | 4-[(4-methylidenepiperidin-1-yl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 130439053 |
| Molecular Formula | C28H29N4OP |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[(4-methylidenepiperidin-1-yl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]benzonitrile |
| SMILES | C=C1CCN(C(c2ccc(C#N)cc2)P2(=O)N(c3ccccc3)CCN2c2ccccc2)CC1 |
| InChI | InChI=1S/C28H29N4OP/c1-23-16-18-30(19-17-23)28(25-14-12-24(22-29)13-15-25)34(33)31(26-8-4-2-5-9-26)20-21-32(34)27-10-6-3-7-11-27/h2-15,28H,1,16-21H2 |
| InChIKey | ZTFRAGXCPFBLSH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|