C26H30FN4OP — CID 130439068
2-[(2-fluorophenyl)-(4-methylpiperazin-1-yl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 130439068) has the molecular formula C26H30FN4OP and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)-(4-methylpiperazin-1-yl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 2-[(2-fluorophenyl)-(4-methylpiperazin-1-yl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 130439068 |
| Molecular Formula | C26H30FN4OP |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[(2-fluorophenyl)-(4-methylpiperazin-1-yl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CN1CCN(C(c2ccccc2F)P2(=O)N(c3ccccc3)CCN2c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30FN4OP/c1-28-16-18-29(19-17-28)26(24-14-8-9-15-25(24)27)33(32)30(22-10-4-2-5-11-22)20-21-31(33)23-12-6-3-7-13-23/h2-15,26H,16-21H2,1H3 |
| InChIKey | ULGXZFIZBVBMBO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|