C28H32N3OP — CID 130439078
2-[(4-methylidenepiperidin-1-yl)-(2-methylphenyl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 130439078) has the molecular formula C28H32N3OP and a molecular weight of 457.56 g/mol. Its IUPAC name is 2-[(4-methylidenepiperidin-1-yl)-(2-methylphenyl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 2-[(4-methylidenepiperidin-1-yl)-(2-methylphenyl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 130439078 |
| Molecular Formula | C28H32N3OP |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-[(4-methylidenepiperidin-1-yl)-(2-methylphenyl)methyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | C=C1CCN(C(c2ccccc2C)P2(=O)N(c3ccccc3)CCN2c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N3OP/c1-23-17-19-29(20-18-23)28(27-16-10-9-11-24(27)2)33(32)30(25-12-5-3-6-13-25)21-22-31(33)26-14-7-4-8-15-26/h3-16,28H,1,17-22H2,2H3 |
| InChIKey | FWMBOBDDDHKLOX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|