C21H21N2P — CID 130439099
(4R,5R)-1-methyl-3,4,5-triphenyl-1,3,2-diazaphospholidine (PubChem CID 130439099) has the molecular formula C21H21N2P and a molecular weight of 332.39 g/mol. Its IUPAC name is (4R,5R)-1-methyl-3,4,5-triphenyl-1,3,2-diazaphospholidine.
| Compound Name | (4R,5R)-1-methyl-3,4,5-triphenyl-1,3,2-diazaphospholidine |
|---|---|
| PubChem CID | 130439099 |
| Molecular Formula | C21H21N2P |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (4R,5R)-1-methyl-3,4,5-triphenyl-1,3,2-diazaphospholidine |
| SMILES | CN1PN(c2ccccc2)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21N2P/c1-22-20(17-11-5-2-6-12-17)21(18-13-7-3-8-14-18)23(24-22)19-15-9-4-10-16-19/h2-16,20-21,24H,1H3/t20-,21-/m1/s1 |
| InChIKey | HAGRIJJDZIBUPE-NHCUHLMSSA-N |
| XLogP | 5.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|