C25H27BrN3O2P — CID 130439169
2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 130439169) has the molecular formula C25H27BrN3O2P and a molecular weight of 512.39 g/mol. Its IUPAC name is 2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 130439169 |
| Molecular Formula | C25H27BrN3O2P |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | 2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | O=P1(C(c2ccc(Br)cc2)N2CCOCC2)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C25H27BrN3O2P/c26-22-13-11-21(12-14-22)25(27-17-19-31-20-18-27)32(30)28(23-7-3-1-4-8-23)15-16-29(32)24-9-5-2-6-10-24/h1-14,25H,15-20H2 |
| InChIKey | HNYFOTVAOKUMSP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|