About 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine
2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine (PubChem CID 130439173) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine |
| PubChem CID | 130439173 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine |
| SMILES | C=CNc1nc(C)c(C)cc1N |
| InChI | InChI=1S/C9H13N3/c1-4-11-9-8(10)5-6(2)7(3)12-9/h4-5H,1,10H2,2-3H3,(H,11,12) |
| InChIKey | RUGOFOFEARKMLI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine?
The IUPAC name of 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine (CID 130439173) is 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine.
What is the SMILES notation for 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine?
The canonical SMILES for 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine is C=CNc1nc(C)c(C)cc1N.
What is the InChIKey of 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine?
The InChIKey is RUGOFOFEARKMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-4-11-9-8(10)5-6(2)7(3)12-9/h4-5H,1,10H2,2-3H3,(H,11,12).
What are the key properties of 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine?
2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine has a molecular weight of 163.22 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethenyl-5,6-dimethylpyridine-2,3-diamine is sourced from PubChem (CID 130439173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).