C18H31FN2 — CID 130439404
(E)-5-fluoro-N',2,5-trimethyl-N-(3-methylbut-1-en-2-yl)-4-methylidene-N-propylhex-2-enimidamide (PubChem CID 130439404) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is (E)-5-fluoro-N',2,5-trimethyl-N-(3-methylbut-1-en-2-yl)-4-methylidene-N-propylhex-2-enimidamide.
| Compound Name | (E)-5-fluoro-N',2,5-trimethyl-N-(3-methylbut-1-en-2-yl)-4-methylidene-N-propylhex-2-enimidamide |
|---|---|
| PubChem CID | 130439404 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | (E)-5-fluoro-N',2,5-trimethyl-N-(3-methylbut-1-en-2-yl)-4-methylidene-N-propylhex-2-enimidamide |
| SMILES | C=C(C(C)C)N(CCC)C(=N/C)/C(C)=C/C(=C)C(C)(C)F |
| InChI | InChI=1S/C18H31FN2/c1-10-11-21(16(6)13(2)3)17(20-9)14(4)12-15(5)18(7,8)19/h12-13H,5-6,10-11H2,1-4,7-9H3/b14-12+,20-17+ |
| InChIKey | GFQYMTKJOAIMIM-KTMWLEFISA-N |
| XLogP | 5.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|