C19H33FN2 — CID 130439459
N-[(3E)-6-fluoro-3,4-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N',2-dimethyl-N-propylbutanimidamide (PubChem CID 130439459) has the molecular formula C19H33FN2 and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[(3E)-6-fluoro-3,4-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N',2-dimethyl-N-propylbutanimidamide.
| Compound Name | N-[(3E)-6-fluoro-3,4-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N',2-dimethyl-N-propylbutanimidamide |
|---|---|
| PubChem CID | 130439459 |
| Molecular Formula | C19H33FN2 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | N-[(3E)-6-fluoro-3,4-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N',2-dimethyl-N-propylbutanimidamide |
| SMILES | C=C(/C(C)=C(\C)C(=C)N(CCC)/C(=N/C)C(C)CC)C(C)F |
| InChI | InChI=1S/C19H33FN2/c1-10-12-22(19(21-9)13(3)11-2)18(8)16(6)14(4)15(5)17(7)20/h13,17H,5,8,10-12H2,1-4,6-7,9H3/b16-14+,21-19+ |
| InChIKey | JUAHPSZBRDETGK-JGYMCNJKSA-N |
| XLogP | 5.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|