C16H17N7OS — CID 130439463
4-[4-[amino-(3-methyl-1,2,4-thiadiazol-5-yl)methyl]-3-iminopiperazine-1-carbonyl]benzonitrile (PubChem CID 130439463) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-[4-[amino-(3-methyl-1,2,4-thiadiazol-5-yl)methyl]-3-iminopiperazine-1-carbonyl]benzonitrile.
| Compound Name | 4-[4-[amino-(3-methyl-1,2,4-thiadiazol-5-yl)methyl]-3-iminopiperazine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 130439463 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[4-[amino-(3-methyl-1,2,4-thiadiazol-5-yl)methyl]-3-iminopiperazine-1-carbonyl]benzonitrile |
| SMILES | [H]/N=C1\CN(C(=O)c2ccc(C#N)cc2)CCN1C(N)c1nc(C)ns1 |
| InChI | InChI=1S/C16H17N7OS/c1-10-20-15(25-21-10)14(19)23-7-6-22(9-13(23)18)16(24)12-4-2-11(8-17)3-5-12/h2-5,14,18H,6-7,9,19H2,1H3/b18-13+ |
| InChIKey | FGVOPZHOZAYDDN-QGOAFFKASA-N |
| XLogP | 1.11 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|