About (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate
(4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate (PubChem CID 130439490) has the molecular formula C5H9FO5S2
and a molecular weight of 232.25 g/mol. Its IUPAC name is (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate.
Molecular Properties
| Compound Name | (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate |
| PubChem CID | 130439490 |
| Molecular Formula | C5H9FO5S2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC1CS(=O)(=O)CC1F |
| InChI | InChI=1S/C5H9FO5S2/c1-12(7,8)11-5-3-13(9,10)2-4(5)6/h4-5H,2-3H2,1H3 |
| InChIKey | FQEXWLJVLJDWNG-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate?
The IUPAC name of (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate (CID 130439490) is (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate.
What is the SMILES notation for (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate?
The canonical SMILES for (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate is CS(=O)(=O)OC1CS(=O)(=O)CC1F.
What is the InChIKey of (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate?
The InChIKey is FQEXWLJVLJDWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO5S2/c1-12(7,8)11-5-3-13(9,10)2-4(5)6/h4-5H,2-3H2,1H3.
What are the key properties of (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate?
(4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate has a molecular weight of 232.25 g/mol, XLogP of -0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-1,1-dioxothiolan-3-yl) methanesulfonate is sourced from PubChem (CID 130439490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).