About [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate
[1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate (PubChem CID 130439492) has the molecular formula C6H9F3O5S2
and a molecular weight of 282.26 g/mol. Its IUPAC name is [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate |
| PubChem CID | 130439492 |
| Molecular Formula | C6H9F3O5S2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CS(=O)(=O)CC1C(F)(F)F |
| InChI | InChI=1S/C6H9F3O5S2/c1-15(10,11)14-5-3-16(12,13)2-4(5)6(7,8)9/h4-5H,2-3H2,1H3 |
| InChIKey | RNACOQNZZSOZOW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate?
The IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate (CID 130439492) is [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate.
What is the SMILES notation for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate?
The canonical SMILES for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate is CS(=O)(=O)OC1CS(=O)(=O)CC1C(F)(F)F.
What is the InChIKey of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate?
The InChIKey is RNACOQNZZSOZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O5S2/c1-15(10,11)14-5-3-16(12,13)2-4(5)6(7,8)9/h4-5H,2-3H2,1H3.
What are the key properties of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate?
[1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate has a molecular weight of 282.26 g/mol, XLogP of -0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl] methanesulfonate is sourced from PubChem (CID 130439492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).