C19H23F2NO — CID 130439660
N-[(2,6-difluorophenyl)methoxy]-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-2-methylpent-2-en-3-amine (PubChem CID 130439660) has the molecular formula C19H23F2NO and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methoxy]-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-2-methylpent-2-en-3-amine.
| Compound Name | N-[(2,6-difluorophenyl)methoxy]-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-2-methylpent-2-en-3-amine |
|---|---|
| PubChem CID | 130439660 |
| Molecular Formula | C19H23F2NO |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(2,6-difluorophenyl)methoxy]-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-2-methylpent-2-en-3-amine |
| SMILES | C=C/C=C\C=C/N(OCc1c(F)cccc1F)C(CC)=C(C)C |
| InChI | InChI=1S/C19H23F2NO/c1-5-7-8-9-13-22(19(6-2)15(3)4)23-14-16-17(20)11-10-12-18(16)21/h5,7-13H,1,6,14H2,2-4H3/b8-7-,13-9- |
| InChIKey | LGSLDUBCOPMEPK-VBKTUFRMSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|