About 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene
2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene (PubChem CID 130439921) has the molecular formula C19H20Br2O
and a molecular weight of 424.18 g/mol. Its IUPAC name is 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene |
| PubChem CID | 130439921 |
| Molecular Formula | C19H20Br2O |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene |
| SMILES | CC(C)Cc1cc2c(cc1Br)C(C)(C)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C19H20Br2O/c1-11(2)7-12-8-18-15(10-16(12)21)19(3,4)14-9-13(20)5-6-17(14)22-18/h5-6,8-11H,7H2,1-4H3 |
| InChIKey | NURKVWVFVBRESK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene?
The IUPAC name of 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene (CID 130439921) is 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene.
What is the SMILES notation for 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene?
The canonical SMILES for 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene is CC(C)Cc1cc2c(cc1Br)C(C)(C)c1cc(Br)ccc1O2.
What is the InChIKey of 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene?
The InChIKey is NURKVWVFVBRESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Br2O/c1-11(2)7-12-8-18-15(10-16(12)21)19(3,4)14-9-13(20)5-6-17(14)22-18/h5-6,8-11H,7H2,1-4H3.
What are the key properties of 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene?
2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene has a molecular weight of 424.18 g/mol, XLogP of 6.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-dimethyl-3-(2-methylpropyl)xanthene is sourced from PubChem (CID 130439921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).