C56H42N6S — CID 130440062
2-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]-4-[4-[8-[4-[4-(2-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 130440062) has the molecular formula C56H42N6S and a molecular weight of 831.06 g/mol. Its IUPAC name is 2-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]-4-[4-[8-[4-[4-(2-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]-4-[4-[8-[4-[4-(2-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 130440062 |
| Molecular Formula | C56H42N6S |
| Molecular Weight | 831.06 g/mol |
| Exact Mass | 830.32 |
| IUPAC Name | 2-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]-4-[4-[8-[4-[4-(2-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C(C)=C(/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4sc5ccc(-c6ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8C)n7)cc6)cc5c4c3)cc2)n1 |
| InChI | InChI=1S/C56H42N6S/c1-5-14-35(2)37(4)51-57-52(40-16-8-6-9-17-40)59-54(58-51)42-25-21-38(22-26-42)44-29-31-49-47(33-44)48-34-45(30-32-50(48)63-49)39-23-27-43(28-24-39)55-60-53(41-18-10-7-11-19-41)61-56(62-55)46-20-13-12-15-36(46)3/h5-34H,1-4H3/b14-5-,37-35+ |
| InChIKey | UDAZITFSWASRTC-BZWOSKCMSA-N |
| XLogP | 14.77 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.06 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|