(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid

C7H9NO2 — CID 130440427

IUPAC(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid
SMILESC=N/C=C(\C=C/C)C(=O)O
InChIInChI=1S/C7H9NO2/c1-3-4-6(5-8-2)7(9)10/h3-5H,2H2,1H3,(H,9,10)/b4-3-,6-5+
InChIKeyGTACKPAKJKATCD-DNVGVPOPSA-N
MW139.15 g/mol
LogP1.23
Rot. Bonds3

About (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid

(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid (PubChem CID 130440427) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid.

Molecular Properties

Compound Name(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid
PubChem CID130440427
Molecular FormulaC7H9NO2
Molecular Weight139.15 g/mol
Exact Mass139.06
IUPAC Name(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid
SMILESC=N/C=C(\C=C/C)C(=O)O
InChIInChI=1S/C7H9NO2/c1-3-4-6(5-8-2)7(9)10/h3-5H,2H2,1H3,(H,9,10)/b4-3-,6-5+
InChIKeyGTACKPAKJKATCD-DNVGVPOPSA-N
XLogP1.23
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.15
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid?
The IUPAC name of (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid (CID 130440427) is (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid.
What is the SMILES notation for (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid?
The canonical SMILES for (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid is C=N/C=C(\C=C/C)C(=O)O.
What is the InChIKey of (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid?
The InChIKey is GTACKPAKJKATCD-DNVGVPOPSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-4-6(5-8-2)7(9)10/h3-5H,2H2,1H3,(H,9,10)/b4-3-,6-5+.
What are the key properties of (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid?
(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid has a molecular weight of 139.15 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-2-[(methylideneamino)methylidene]pent-3-enoic acid is sourced from PubChem (CID 130440427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).