About (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene
(3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene (PubChem CID 130440432) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene.
Analyze (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene?
The IUPAC name of (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene (CID 130440432) is (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene.
What is the SMILES notation for (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene?
The canonical SMILES for (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene is CC1(C)/C=C\N=C=C/C=N\1.
What is the InChIKey of (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene?
The InChIKey is WWYAYALBGWOPIO-OBWMJXCISA-N. The full InChI is InChI=1S/C8H10N2/c1-8(2)4-7-9-5-3-6-10-8/h3-4,6-7H,1-2H3/b7-4-,10-6-.
What are the key properties of (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene?
(3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene has a molecular weight of 134.18 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2,2-dimethyl-1,5-diazacycloocta-3,5,6,8-tetraene is sourced from PubChem (CID 130440432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).