C33H41F3N8S — CID 130440704
1-[2-[(3R,5R)-3,5-dimethylpiperazin-1-yl]propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 130440704) has the molecular formula C33H41F3N8S and a molecular weight of 638.81 g/mol. Its IUPAC name is 1-[2-[(3R,5R)-3,5-dimethylpiperazin-1-yl]propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 1-[2-[(3R,5R)-3,5-dimethylpiperazin-1-yl]propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 130440704 |
| Molecular Formula | C33H41F3N8S |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 1-[2-[(3R,5R)-3,5-dimethylpiperazin-1-yl]propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CC(C)N1C[C@@H](C)N[C@H](C)C1 |
| InChI | InChI=1S/C33H41F3N8S/c1-20-15-43(16-21(2)40-20)22(3)17-44-26(14-37)11-28-23(4)24(5-6-30(28)44)18-42-9-7-25(8-10-42)41-31-29-12-27(13-33(34,35)36)45-32(29)39-19-38-31/h5-6,11-12,19-22,25,40H,7-10,13,15-18H2,1-4H3,(H,38,39,41)/t20-,21-,22?/m1/s1 |
| InChIKey | LIDLMCIAWUYDFX-JAZPPYFYSA-N |
| XLogP | 6.08 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |