C18H32N2O9 — CID 130440881
5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid (PubChem CID 130440881) has the molecular formula C18H32N2O9 and a molecular weight of 420.46 g/mol. Its IUPAC name is 5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid.
| Compound Name | 5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 130440881 |
| Molecular Formula | C18H32N2O9 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid |
| SMILES | CC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H32N2O9/c1-15(21)13-28-11-9-27-8-6-20-17(23)14-29-12-10-26-7-5-19-16(22)3-2-4-18(24)25/h2-14H2,1H3,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | PMMYXMHWNAVRIE-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|