C39H46N4 — CID 130440911
2-[3-(1,2,4a,10a-tetrahydrophenanthren-9-yl)-5-(3,4-dihydro-2H-pyrrol-5-yl)phenyl]-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane (PubChem CID 130440911) has the molecular formula C39H46N4 and a molecular weight of 570.83 g/mol. Its IUPAC name is 2-[3-(1,2,4a,10a-tetrahydrophenanthren-9-yl)-5-(3,4-dihydro-2H-pyrrol-5-yl)phenyl]-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane.
| Compound Name | 2-[3-(1,2,4a,10a-tetrahydrophenanthren-9-yl)-5-(3,4-dihydro-2H-pyrrol-5-yl)phenyl]-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane |
|---|---|
| PubChem CID | 130440911 |
| Molecular Formula | C39H46N4 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | 2-[3-(1,2,4a,10a-tetrahydrophenanthren-9-yl)-5-(3,4-dihydro-2H-pyrrol-5-yl)phenyl]-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane |
| SMILES | C1=CC2c3ccccc3C(c3cc(C4=NCCC4)cc(C4NC(C5=CCCCC5)NC(C5CC=CCC5)N4)c3)=CC2CC1 |
| InChI | InChI=1S/C39H46N4/c1-3-12-26(13-4-1)37-41-38(27-14-5-2-6-15-27)43-39(42-37)31-23-29(22-30(24-31)36-20-11-21-40-36)35-25-28-16-7-8-17-32(28)33-18-9-10-19-34(33)35/h1,3,8-10,14,17-19,22-26,28,32,37-39,41-43H,2,4-7,11-13,15-16,20-21H2 |
| InChIKey | ONKRCIJTUYUCET-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|