About (2E)-N-(chloromethyl)penta-2,4-dien-2-amine
(2E)-N-(chloromethyl)penta-2,4-dien-2-amine (PubChem CID 130441114) has the molecular formula C6H10ClN
and a molecular weight of 131.61 g/mol. Its IUPAC name is (2E)-N-(chloromethyl)penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-N-(chloromethyl)penta-2,4-dien-2-amine |
| PubChem CID | 130441114 |
| Molecular Formula | C6H10ClN |
| Molecular Weight | 131.61 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | (2E)-N-(chloromethyl)penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NCCl |
| InChI | InChI=1S/C6H10ClN/c1-3-4-6(2)8-5-7/h3-4,8H,1,5H2,2H3/b6-4+ |
| InChIKey | RCJWJMZAEQUGCP-GQCTYLIASA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(chloromethyl)penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(chloromethyl)penta-2,4-dien-2-amine?
The IUPAC name of (2E)-N-(chloromethyl)penta-2,4-dien-2-amine (CID 130441114) is (2E)-N-(chloromethyl)penta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-N-(chloromethyl)penta-2,4-dien-2-amine?
The canonical SMILES for (2E)-N-(chloromethyl)penta-2,4-dien-2-amine is C=C/C=C(\C)NCCl.
What is the InChIKey of (2E)-N-(chloromethyl)penta-2,4-dien-2-amine?
The InChIKey is RCJWJMZAEQUGCP-GQCTYLIASA-N. The full InChI is InChI=1S/C6H10ClN/c1-3-4-6(2)8-5-7/h3-4,8H,1,5H2,2H3/b6-4+.
What are the key properties of (2E)-N-(chloromethyl)penta-2,4-dien-2-amine?
(2E)-N-(chloromethyl)penta-2,4-dien-2-amine has a molecular weight of 131.61 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(chloromethyl)penta-2,4-dien-2-amine is sourced from PubChem (CID 130441114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).