C12H24O — CID 130441371
(2R,3S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yl)oxolane (PubChem CID 130441371) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yl)oxolane.
| Compound Name | (2R,3S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yl)oxolane |
|---|---|
| PubChem CID | 130441371 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (2R,3S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yl)oxolane |
| SMILES | CC(C)[C@H]1O[C@@H](C(C)C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H24O/c1-7(2)11-9(5)10(6)12(13-11)8(3)4/h7-12H,1-6H3/t9-,10+,11+,12- |
| InChIKey | YLFXZAFXXPRRLO-IWDIQUIJSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |