C8H10N2 — CID 130441703
(2E,4Z)-2,4-dimethyl-5-(methylideneamino)penta-2,4-dienenitrile (PubChem CID 130441703) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (2E,4Z)-2,4-dimethyl-5-(methylideneamino)penta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2,4-dimethyl-5-(methylideneamino)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 130441703 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2E,4Z)-2,4-dimethyl-5-(methylideneamino)penta-2,4-dienenitrile |
| SMILES | C=N/C=C(C)\C=C(/C)C#N |
| InChI | InChI=1S/C8H10N2/c1-7(5-9)4-8(2)6-10-3/h4,6H,3H2,1-2H3/b7-4+,8-6- |
| InChIKey | LBOGTYODRGLZOH-MTCKZIEXSA-N |
| XLogP | 2.06 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|